(5R,8R,9S,14R,15R,17S,21R,24S,26R,27S)-5,14,15-trihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone
Internal ID | d26c25fe-7050-434a-99f6-b659f1099f7e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Physalins and derivatives |
IUPAC Name | (5R,8R,9S,14R,15R,17S,21R,24S,26R,27S)-5,14,15-trihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone |
SMILES (Canonical) | CC12CC3C4(C56C1C(=O)C(O5)(C7CC(C8(CC=CC(=O)C8(C7CCC6(C(=O)O4)O)C)O)O)OCC2C(=O)O3)C |
SMILES (Isomeric) | C[C@@]12C[C@H]3C4(C56[C@H]1C(=O)C(O5)([C@H]7C[C@H]([C@]8(CC=CC(=O)[C@]8([C@@H]7CC[C@@]6(C(=O)O4)O)C)O)O)OC[C@@H]2C(=O)O3)C |
InChI | InChI=1S/C28H32O11/c1-22-10-17-24(3)28-18(22)19(31)27(39-28,36-11-14(22)20(32)37-17)13-9-16(30)25(34)7-4-5-15(29)23(25,2)12(13)6-8-26(28,35)21(33)38-24/h4-5,12-14,16-18,30,34-35H,6-11H2,1-3H3/t12-,13+,14-,16-,17+,18+,22+,23-,24?,25+,26+,27?,28?/m1/s1 |
InChI Key | DUGJJSWZRHBJJK-WOJZHMGFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O11 |
Molecular Weight | 544.50 g/mol |
Exact Mass | 544.19446183 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of (5R,8R,9S,14R,15R,17S,21R,24S,26R,27S)-5,14,15-trihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone 2D Structure of (5R,8R,9S,14R,15R,17S,21R,24S,26R,27S)-5,14,15-trihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone](https://plantaedb.com/storage/docs/compounds/2023/11/5788a160-825f-11ee-9c8e-db82d8d38667.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.66% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.48% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.43% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.87% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.56% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.38% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.02% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.61% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.15% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.10% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.62% | 94.80% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.03% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.28% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.35% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.53% | 94.45% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.51% | 95.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.41% | 90.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.66% | 97.79% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.25% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.66% | 98.95% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.35% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis angulata |
Physalis lagascae |
Physalis minima |
Physalis pubescens |
PubChem | 139594808 |
LOTUS | LTS0216475 |
wikiData | Q104388184 |