[4-[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-4-oxo-1H-naphthalen-2-yl]phenyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
Internal ID | 66179e5d-fff0-4764-9f28-5094dfd77045 |
Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
IUPAC Name | [4-[6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-4-oxo-1H-naphthalen-2-yl]phenyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OC2=CC=C(C=C2)C3=CC(=O)C4=C(C(=C(C=C4C3)O)C5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OC2=CC=C(C=C2)C3=CC(=O)C4=C(C(=C(C=C4C3)O)C5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
InChI | InChI=1S/C39H42O18/c1-52-23-9-16(10-24(53-2)30(23)45)3-8-27(44)54-20-6-4-17(5-7-20)18-11-19-13-22(43)29(33(48)28(19)21(42)12-18)37-38(35(50)32(47)25(14-40)55-37)57-39-36(51)34(49)31(46)26(15-41)56-39/h3-10,12-13,25-26,31-32,34-41,43,45-51H,11,14-15H2,1-2H3 |
InChI Key | RLUNZDBRDATPEN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H42O18 |
Molecular Weight | 798.70 g/mol |
Exact Mass | 798.23711449 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.63% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 97.50% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.95% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.51% | 95.56% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 94.17% | 97.53% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.71% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.88% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.21% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.28% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.15% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.96% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.07% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.77% | 95.93% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.66% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.03% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.86% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.04% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.84% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.66% | 96.21% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.04% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.52% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.99% | 91.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.63% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eutrema salsugineum |
PubChem | 162972849 |
LOTUS | LTS0158039 |
wikiData | Q105240534 |