dimethyl (1S,4S,5R,6S,7R,8R,10S,14S,16R,18S,19R,22S,23R,25S,26R)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6-methyl-25-(2-methylbutanoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4,22-dicarboxylate
Internal ID | 3b059d7f-0338-4f91-8286-6d33dbf50463 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | dimethyl (1S,4S,5R,6S,7R,8R,10S,14S,16R,18S,19R,22S,23R,25S,26R)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6-methyl-25-(2-methylbutanoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4,22-dicarboxylate |
SMILES (Canonical) | CCC(C)C(=O)OC1CC(C2(COC3C2C14COC(C4C5(C3OC6C5(C7CC6C8(C=COC8O7)O)O)C)(C(=O)OC)OC)C(=O)OC)OC(=O)C |
SMILES (Isomeric) | CCC(C)C(=O)O[C@H]1C[C@H]([C@]2(CO[C@@H]3[C@@H]2[C@]14CO[C@@]([C@H]4[C@]5([C@@H]3O[C@H]6[C@@]5([C@H]7CC6[C@]8(C=CO[C@H]8O7)O)O)C)(C(=O)OC)OC)C(=O)OC)OC(=O)C |
InChI | InChI=1S/C35H46O16/c1-8-15(2)25(37)49-18-12-19(48-16(3)36)32(27(38)42-5)13-46-21-22(32)31(18)14-47-35(44-7,28(39)43-6)26(31)30(4)24(21)51-23-17-11-20(34(23,30)41)50-29-33(17,40)9-10-45-29/h9-10,15,17-24,26,29,40-41H,8,11-14H2,1-7H3/t15?,17?,18-,19+,20+,21+,22+,23+,24+,26-,29-,30+,31-,32-,33-,34+,35-/m0/s1 |
InChI Key | ZHEQVVAETFPOND-PDPSVSLISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H46O16 |
Molecular Weight | 722.70 g/mol |
Exact Mass | 722.27858538 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | -0.10 |
Atomic LogP (AlogP) | 0.14 |
H-Bond Acceptor | 16 |
H-Bond Donor | 2 |
Rotatable Bonds | 7 |
There are no found synonyms. |
![2D Structure of dimethyl (1S,4S,5R,6S,7R,8R,10S,14S,16R,18S,19R,22S,23R,25S,26R)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6-methyl-25-(2-methylbutanoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4,22-dicarboxylate 2D Structure of dimethyl (1S,4S,5R,6S,7R,8R,10S,14S,16R,18S,19R,22S,23R,25S,26R)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6-methyl-25-(2-methylbutanoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4,22-dicarboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/57679770-811f-11ee-8b8a-f72bea4e39ce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9063 | 90.63% |
Caco-2 | - | 0.8357 | 83.57% |
Blood Brain Barrier | + | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.7392 | 73.92% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8122 | 81.22% |
OATP1B3 inhibitior | + | 0.9104 | 91.04% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.9631 | 96.31% |
P-glycoprotein inhibitior | + | 0.7508 | 75.08% |
P-glycoprotein substrate | + | 0.7406 | 74.06% |
CYP3A4 substrate | + | 0.7324 | 73.24% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8763 | 87.63% |
CYP3A4 inhibition | - | 0.8268 | 82.68% |
CYP2C9 inhibition | - | 0.8451 | 84.51% |
CYP2C19 inhibition | - | 0.7954 | 79.54% |
CYP2D6 inhibition | - | 0.9540 | 95.40% |
CYP1A2 inhibition | - | 0.9168 | 91.68% |
CYP2C8 inhibition | + | 0.7539 | 75.39% |
CYP inhibitory promiscuity | - | 0.8334 | 83.34% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5196 | 51.96% |
Eye corrosion | - | 0.9887 | 98.87% |
Eye irritation | - | 0.9128 | 91.28% |
Skin irritation | - | 0.7332 | 73.32% |
Skin corrosion | - | 0.9440 | 94.40% |
Ames mutagenesis | - | 0.5300 | 53.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4204 | 42.04% |
Micronuclear | - | 0.6700 | 67.00% |
Hepatotoxicity | - | 0.5296 | 52.96% |
skin sensitisation | - | 0.8870 | 88.70% |
Respiratory toxicity | + | 0.6222 | 62.22% |
Reproductive toxicity | + | 0.7000 | 70.00% |
Mitochondrial toxicity | + | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.6134 | 61.34% |
Acute Oral Toxicity (c) | I | 0.4478 | 44.78% |
Estrogen receptor binding | + | 0.7989 | 79.89% |
Androgen receptor binding | + | 0.7562 | 75.62% |
Thyroid receptor binding | + | 0.5184 | 51.84% |
Glucocorticoid receptor binding | + | 0.7221 | 72.21% |
Aromatase binding | + | 0.7089 | 70.89% |
PPAR gamma | + | 0.7349 | 73.49% |
Honey bee toxicity | - | 0.8061 | 80.61% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9637 | 96.37% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.39% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.38% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.32% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.71% | 94.45% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 93.90% | 89.50% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.02% | 85.30% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.92% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.53% | 96.61% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.37% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.77% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.23% | 91.19% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.84% | 82.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.30% | 94.33% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.16% | 97.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.98% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.48% | 96.47% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.99% | 96.00% |
CHEMBL4072 | P07858 | Cathepsin B | 85.54% | 93.67% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.53% | 93.10% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.43% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 83.43% | 98.95% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 83.05% | 95.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.01% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.01% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.78% | 95.71% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.71% | 95.93% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.53% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.46% | 86.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.37% | 95.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.33% | 98.75% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.11% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.68% | 100.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.55% | 97.28% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.08% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.00% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.85% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.81% | 99.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.61% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.45% | 95.89% |
CHEMBL3776 | Q14790 | Caspase-8 | 80.33% | 97.06% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
PubChem | 54586223 |
LOTUS | LTS0049189 |
wikiData | Q105375674 |