5,7,4',5'-Tetrahydroxy-3,2'-dimethoxyflavone
| Internal ID | 16c1d9c6-af3e-4bcb-8ab0-b311e6cfacb8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
| IUPAC Name | 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC)O)O |
| InChI | InChI=1S/C17H14O8/c1-23-12-6-10(20)9(19)5-8(12)16-17(24-2)15(22)14-11(21)3-7(18)4-13(14)25-16/h3-6,18-21H,1-2H3 |
| InChI Key | MYTOPZXHMOAXSZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.06886740 g/mol |
| Topological Polar Surface Area (TPSA) | 126.00 Ų |
| XlogP | 1.80 |
| CHEBI:187031 |
| C17H14O8 |
| LMPK12112523 |
| 2-(4,5-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.28% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.36% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.26% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 91.70% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.62% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.99% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.53% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.42% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.38% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.08% | 90.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.67% | 94.42% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 82.20% | 96.12% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.64% | 91.49% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 81.22% | 98.21% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.19% | 80.78% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.93% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gymnosperma glutinosum |
| PubChem | 13942681 |
| LOTUS | LTS0061527 |
| wikiData | Q105175162 |