5,7,4'-Trihydroxy-8-(1,1-dimethylallyl)flavanone
| Internal ID | 27deef60-e2a9-4dce-9faa-1236882fe581 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC(C)(C=C)C1=C(C=C(C2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)O |
| SMILES (Isomeric) | CC(C)(C=C)C1=C(C=C(C2=C1O[C@@H](CC2=O)C3=CC=C(C=C3)O)O)O |
| InChI | InChI=1S/C20H20O5/c1-4-20(2,3)18-15(24)9-13(22)17-14(23)10-16(25-19(17)18)11-5-7-12(21)8-6-11/h4-9,16,21-22,24H,1,10H2,2-3H3/t16-/m0/s1 |
| InChI Key | QEGKZPOCQRZIAS-INIZCTEOSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 4.30 |
| 5,7,4'-Trihydroxy-8-(1,1-dimethylallyl)flavanone |
| LMPK12140297 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.28% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.51% | 98.95% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 89.87% | 90.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.80% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.79% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.66% | 97.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.61% | 85.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.58% | 86.33% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 83.51% | 98.35% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.41% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.64% | 96.09% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 82.44% | 80.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.29% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.27% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.15% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.27% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.16% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helminthostachys zeylanica |
| PubChem | 12114693 |
| LOTUS | LTS0079096 |
| wikiData | Q76422706 |