5,7,4'-Trihydroxy-3'-methoxy-8-prenylisoflavone
Internal ID | c731a322-9ed0-4abd-8d3f-345315876e8c |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 3-O-methylated isoflavonoids > 3-O-methylisoflavones |
IUPAC Name | 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=CO2)C3=CC(=C(C=C3)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=CO2)C3=CC(=C(C=C3)O)OC)C |
InChI | InChI=1S/C21H20O6/c1-11(2)4-6-13-16(23)9-17(24)19-20(25)14(10-27-21(13)19)12-5-7-15(22)18(8-12)26-3/h4-5,7-10,22-24H,6H2,1-3H3 |
InChI Key | OZVILOLUKCJYAQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 4.60 |
CHEMBL5170827 |
LMPK12050256 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.43% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.36% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.28% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.10% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.98% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.46% | 94.73% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.63% | 98.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.46% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.41% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.85% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.13% | 95.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.61% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.46% | 97.28% |
CHEMBL3194 | P02766 | Transthyretin | 84.19% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.17% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Wyethia mollis |
PubChem | 14258998 |
LOTUS | LTS0230990 |
wikiData | Q105204154 |