5,7,4'-Tri-O-methylcatechin
Internal ID | c90b3f43-ef3a-4449-9d5b-31568039ae22 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins |
IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2C(CC3=C(O2)C=C(C=C3OC)OC)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2C(CC3=C(O2)C=C(C=C3OC)OC)O)O |
InChI | InChI=1S/C18H20O6/c1-21-11-7-16(23-3)12-9-14(20)18(24-17(12)8-11)10-4-5-15(22-2)13(19)6-10/h4-8,14,18-20H,9H2,1-3H3 |
InChI Key | WCBCDLSKTYUDDL-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H20O6 |
Molecular Weight | 332.30 g/mol |
Exact Mass | 332.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 77.40 Ų |
XlogP | 1.30 |
105330-59-4 |
2-(3-hydroxy-4-methoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol |
3,3'-Dihydroxy-4',5,7-trimethoxyflavan |
2-(3-Hydroxy-4-methoxyphenyl)-5,7-dimethoxychroman-3-ol |
starbld0005268 |
SCHEMBL1973504 |
4',5,7-Tri-O-methylcatechin |
CHEBI:175243 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.31% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.07% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.34% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.90% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.62% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.40% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 88.05% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.92% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.73% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.59% | 86.33% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.91% | 88.48% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.67% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.34% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.78% | 89.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.55% | 82.67% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.63% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.26% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Byrsonima microphylla |
PubChem | 67233312 |
LOTUS | LTS0069323 |
wikiData | Q105301281 |