2-(hydroxymethyl)-6-[[17-[5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol
| Internal ID | 0192715c-4469-4c06-b13d-4465a69626f2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 2-(hydroxymethyl)-6-[[17-[5-hydroxy-5-propan-2-yl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
| SMILES (Canonical) | CC(C)C(CCC(C)C1CC=C2C1(CCC3=C2CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)(C(C)OC6C(C(C(C(O6)CO)O)O)O)O |
| SMILES (Isomeric) | CC(C)C(CCC(C)C1CC=C2C1(CCC3=C2CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)(C(C)OC6C(C(C(C(O6)CO)O)O)O)O |
| InChI | InChI=1S/C41H68O13/c1-20(2)41(50,22(4)51-37-35(48)33(46)31(44)29(18-42)53-37)16-11-21(3)26-9-10-27-25-8-7-23-17-24(12-14-39(23,5)28(25)13-15-40(26,27)6)52-38-36(49)34(47)32(45)30(19-43)54-38/h10,20-24,26,29-38,42-50H,7-9,11-19H2,1-6H3 |
| InChI Key | GURWOVBTHOKGAB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H68O13 |
| Molecular Weight | 769.00 g/mol |
| Exact Mass | 768.46599222 g/mol |
| Topological Polar Surface Area (TPSA) | 219.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.16% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.25% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.69% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 95.58% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.33% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.71% | 100.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 89.55% | 94.23% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.43% | 98.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.03% | 95.89% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.00% | 89.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.20% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.43% | 95.93% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 84.22% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.77% | 89.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.53% | 98.10% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.47% | 92.62% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.84% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.40% | 97.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.15% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Decaneuropsis cumingiana |
| PubChem | 75235602 |
| LOTUS | LTS0102870 |
| wikiData | Q105020402 |