5,7,2',3'-Tetramethoxyflavanone
Internal ID | 4d09b29b-0a15-4cb5-9297-08462f7af09f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(2,3-dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=CC(=C1OC)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC |
SMILES (Isomeric) | COC1=CC=CC(=C1OC)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC |
InChI | InChI=1S/C19H20O6/c1-21-11-8-16(23-3)18-13(20)10-15(25-17(18)9-11)12-6-5-7-14(22-2)19(12)24-4/h5-9,15H,10H2,1-4H3 |
InChI Key | LISGXNMNBMLGFM-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 63.20 Ų |
XlogP | 2.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.46% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.53% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 92.57% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 90.26% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.21% | 85.14% |
CHEMBL240 | Q12809 | HERG | 88.43% | 89.76% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.19% | 99.23% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.09% | 94.80% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.39% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.93% | 95.89% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.84% | 94.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.81% | 93.99% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 85.98% | 89.32% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.96% | 94.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.89% | 93.31% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.98% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.82% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.69% | 94.45% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 83.69% | 96.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.27% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.59% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.61% | 99.17% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.57% | 100.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.06% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis paniculata |
PubChem | 21579286 |
LOTUS | LTS0081158 |
wikiData | Q105152346 |