[(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] 3-methylbutanoate
Internal ID | 5e9fce51-0742-4019-97c5-4129a646f3b4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC1CC(CC2C13C(CC4(C2(CCC5C4(CCC6C5(CCC(C6(C)C)OC7C(C(C(CO7)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C)OC3O)C)O)(C)C |
SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1CC(C[C@@H]2[C@@]13[C@@H](C[C@@]4([C@@]2(CC[C@H]5[C@]4(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C)C)O[C@@H]3O)C)O)(C)C |
InChI | InChI=1S/C57H94O24/c1-24(2)16-35(62)77-34-19-51(3,4)17-31-56-15-11-30-53(7)13-12-33(52(5,6)29(53)10-14-54(30,8)55(56,9)18-32(61)57(31,34)50(71)81-56)78-48-44(80-47-43(70)40(67)37(64)26(20-58)74-47)39(66)28(23-73-48)76-49-45(41(68)38(65)27(21-59)75-49)79-46-42(69)36(63)25(60)22-72-46/h24-34,36-50,58-61,63-71H,10-23H2,1-9H3/t25-,26-,27-,28+,29+,30-,31+,32-,33+,34+,36+,37-,38-,39+,40+,41+,42-,43-,44-,45-,46+,47+,48+,49+,50+,53+,54-,55+,56+,57-/m1/s1 |
InChI Key | KHMRAQVBIYRQOZ-OZWMPTMQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C57H94O24 |
Molecular Weight | 1163.30 g/mol |
Exact Mass | 1162.61350386 g/mol |
Topological Polar Surface Area (TPSA) | 372.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] 3-methylbutanoate 2D Structure of [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/57200ec0-83c6-11ee-8ca2-65566295a1ec.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.19% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.79% | 96.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.68% | 91.24% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.96% | 92.98% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 92.48% | 95.36% |
CHEMBL2581 | P07339 | Cathepsin D | 92.29% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.02% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.88% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.46% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.35% | 98.10% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.34% | 82.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.93% | 96.61% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.69% | 91.07% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.58% | 92.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.74% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.63% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.62% | 92.62% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.07% | 96.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.94% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.66% | 96.43% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.37% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.36% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.03% | 100.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.76% | 97.33% |
CHEMBL5028 | O14672 | ADAM10 | 83.07% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.74% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.69% | 92.88% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.68% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.58% | 100.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.45% | 97.28% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.52% | 95.38% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.24% | 96.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.22% | 96.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.55% | 89.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.29% | 91.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.25% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.25% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lysimachia capillipes |
PubChem | 162972638 |
LOTUS | LTS0200152 |
wikiData | Q105141234 |