5,7,2'-Trihydroxyflavanone 7-glucoside
Internal ID | ab799ca2-b64d-418a-b0cf-c9a11afc00c0 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(2-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC=CC=C4O |
SMILES (Isomeric) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC=CC=C4O |
InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-9-5-12(24)17-13(25)7-14(30-15(17)6-9)10-3-1-2-4-11(10)23/h1-6,14,16,18-24,26-28H,7-8H2 |
InChI Key | WXANVFPYSSGKNA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O10 |
Molecular Weight | 434.40 g/mol |
Exact Mass | 434.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.60 |
CHEBI:187041 |
LMPK12140108 |
5-hydroxy-2-(2-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.17% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.96% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.33% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.15% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.39% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.33% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.48% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.30% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.70% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.68% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.06% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.02% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.02% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scutellaria ramosissima |
PubChem | 42607843 |
LOTUS | LTS0132657 |
wikiData | Q105314485 |