[(1S,2R,4R,5S,9S,13R,17S,18S,20S)-9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-19,21,24-trioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate
| Internal ID | 7b41d11b-8801-4987-af46-4539504bb8f3 |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | [(1S,2R,4R,5S,9S,13R,17S,18S,20S)-9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-19,21,24-trioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2C(CCC3C2(CCC4C3(CCCC4(C)CO)C)C)C5OC6C1(O5)CC(=O)O6 |
| SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H]2[C@H](CCC3[C@]2(CCC4[C@@]3(CCC[C@]4(C)CO)C)C)[C@@H]5O[C@@H]6[C@]1(O5)CC(=O)O6 |
| InChI | InChI=1S/C27H40O7/c1-15(29)31-20-12-17-16(22-33-23-27(20,34-22)13-21(30)32-23)6-7-19-25(17,3)11-8-18-24(2,14-28)9-5-10-26(18,19)4/h16-20,22-23,28H,5-14H2,1-4H3/t16-,17+,18?,19?,20+,22+,23+,24+,25-,26-,27-/m0/s1 |
| InChI Key | XLOSRKDRMWLLGT-JWTFLWDTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27740361 g/mol |
| Topological Polar Surface Area (TPSA) | 91.30 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.28% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.54% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.13% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.44% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.13% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.05% | 89.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.93% | 93.04% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.79% | 97.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.34% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.81% | 93.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.39% | 96.77% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.61% | 98.10% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.24% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.23% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.68% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.66% | 97.25% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.49% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21774754 |
| LOTUS | LTS0193850 |
| wikiData | Q105330107 |