5,7-Dimethoxyphenanthren-4-ol
| Internal ID | 86cb438b-dbaf-4df3-b0b6-7e96153c6692 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 5,7-dimethoxyphenanthren-4-ol |
| SMILES (Canonical) | COC1=CC(=C2C(=C1)C=CC3=C2C(=CC=C3)O)OC |
| SMILES (Isomeric) | COC1=CC(=C2C(=C1)C=CC3=C2C(=CC=C3)O)OC |
| InChI | InChI=1S/C16H14O3/c1-18-12-8-11-7-6-10-4-3-5-13(17)15(10)16(11)14(9-12)19-2/h3-9,17H,1-2H3 |
| InChI Key | JOFARSAKDFKTGX-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 4.00 |
| Dehydroloroglossol |
| 5,7-dimethoxyphenanthren-4-ol |
| 5,7-Dimethoxy-4-phenanthrenol |
| 4-Phenanthrenol, 5,7-dimethoxy- |
| SCHEMBL11508747 |
| DTXSID20972139 |
| 5-hydroxy-2,4-dimethoxyphenanthrene |
| A831850 |
| 5,7-dimethoxyphenanthren-4-ol;5-Methylcytosine HCl |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.68% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.94% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.97% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.89% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.86% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.77% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.55% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.11% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.03% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.63% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.34% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.19% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.85% | 99.17% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.42% | 100.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.65% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.62% | 98.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.39% | 95.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.04% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium loddigesii |
| PubChem | 124338 |
| LOTUS | LTS0121791 |
| wikiData | Q82955861 |