5,7-Dimethoxychromone
Internal ID | a0f4414b-6ae2-4f8a-9276-224015b2a492 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
IUPAC Name | 5,7-dimethoxychromen-4-one |
SMILES (Canonical) | COC1=CC2=C(C(=O)C=CO2)C(=C1)OC |
SMILES (Isomeric) | COC1=CC2=C(C(=O)C=CO2)C(=C1)OC |
InChI | InChI=1S/C11H10O4/c1-13-7-5-9(14-2)11-8(12)3-4-15-10(11)6-7/h3-6H,1-2H3 |
InChI Key | KTYBWRXYZHFNSL-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C11H10O4 |
Molecular Weight | 206.19 g/mol |
Exact Mass | 206.05790880 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 1.50 |
5,7-dimethoxychromen-4-one |
59887-91-1 |
5,7-Dimethoxy-4H-chromen-4-one |
5,7-dimethoxy-4-chromenone |
SCHEMBL1472177 |
DTXSID70495247 |
5,7-Dimethoxy-4H-1-benzopyran-4-one |
EN300-7356591 |
Z1551916016 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.13% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.67% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.40% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.28% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.22% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.72% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.42% | 93.99% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.97% | 96.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.74% | 94.03% |
CHEMBL2581 | P07339 | Cathepsin D | 83.28% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.87% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 81.77% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.74% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.56% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia campestris |
PubChem | 12378005 |
LOTUS | LTS0156187 |
wikiData | Q82343225 |