5,7-Dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol
| Internal ID | 16bdb754-26e4-4630-b017-bf22519800d0 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 5,7-dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H16O5/c1-20-12-6-9-4-3-8-5-10(17)7-11(18)13(8)14(9)16(21-2)15(12)19/h5-7,17-19H,3-4H2,1-2H3 |
| InChI Key | UKUPIFBNLKECPT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.82% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.92% | 90.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.86% | 92.68% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.34% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.24% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.86% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.86% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.64% | 94.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.34% | 91.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.76% | 98.75% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.25% | 98.11% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.90% | 95.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.72% | 98.95% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.05% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calanthe discolor |
| PubChem | 10446799 |
| LOTUS | LTS0079688 |
| wikiData | Q105274916 |