5,7-Dihydroxy-8,4'-dimethoxyflavanone
| Internal ID | 4cf4bc75-cd52-4b2f-8381-3e3a2a52d3d8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | (2S)-5,7-dihydroxy-8-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C(=C(C=C3O)O)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)[C@@H]2CC(=O)C3=C(O2)C(=C(C=C3O)O)OC |
| InChI | InChI=1S/C17H16O6/c1-21-10-5-3-9(4-6-10)14-8-12(19)15-11(18)7-13(20)16(22-2)17(15)23-14/h3-7,14,18,20H,8H2,1-2H3/t14-/m0/s1 |
| InChI Key | OEIMDRYTCVDDQH-AWEZNQCLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| RefChem:101376 |
| (2S)-5,7-dihydroxy-8-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| 149155-49-7 |
| LMPK12140648 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.19% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.37% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.27% | 97.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.43% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.93% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.07% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.42% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.70% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.75% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.00% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.16% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.09% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.54% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.19% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chromolaena subscandens |
| PubChem | 42608108 |
| LOTUS | LTS0134188 |
| wikiData | Q76535213 |