5,7-Dihydroxy-8-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-methoxyphenyl)chromen-4-one
| Internal ID | 4791e367-7e40-4586-b084-163a4d165888 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 5,7-dihydroxy-8-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)OC4=CC=C(C=C4)C5=CC(=O)C6=C(C=C(C=C6O5)OC)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)OC4=CC=C(C=C4)C5=CC(=O)C6=C(C=C(C=C6O5)OC)O |
| InChI | InChI=1S/C32H22O10/c1-38-18-7-3-17(4-8-18)27-15-24(36)30-22(34)13-25(37)31(32(30)42-27)40-19-9-5-16(6-10-19)26-14-23(35)29-21(33)11-20(39-2)12-28(29)41-26/h3-15,33-34,37H,1-2H3 |
| InChI Key | JMRBYMXEQLECLU-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H22O10 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.12129689 g/mol |
| Topological Polar Surface Area (TPSA) | 141.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-8-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-methoxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-8-4-5-hydroxy-7-methoxy-4-oxochromen-2-ylphenoxy-2-4-methoxyphenylchromen-4-one.jpg "2D Structure of 5,7-Dihydroxy-8-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-methoxyphenyl)chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 98.65% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.12% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.53% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.64% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.18% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 92.86% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.22% | 98.95% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 87.92% | 91.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.36% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.06% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.94% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.21% | 93.31% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 84.90% | 98.35% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.67% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.46% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.21% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.21% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.13% | 94.45% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.07% | 89.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.43% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.40% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.00% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ouratea semiserrata |
| PubChem | 162861760 |
| LOTUS | LTS0060666 |
| wikiData | Q105131603 |