5,7-Dihydroxy-6-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one
Internal ID | 1e7527d7-b5d3-45ee-9e90-f45ce9977ba0 |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids |
IUPAC Name | 5,7-dihydroxy-6-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C=C2COC3=C(C2=O)C(=C(C(=C3)O)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C=C2COC3=C(C2=O)C(=C(C(=C3)O)OC)O |
InChI | InChI=1S/C18H16O6/c1-22-12-5-3-10(4-6-12)7-11-9-24-14-8-13(19)18(23-2)17(21)15(14)16(11)20/h3-8,19,21H,9H2,1-2H3 |
InChI Key | QGYDSQNKACEOCY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H16O6 |
Molecular Weight | 328.30 g/mol |
Exact Mass | 328.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-6-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one 2D Structure of 5,7-Dihydroxy-6-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-6-methoxy-3-4-methoxyphenylmethylidenechromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.61% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.25% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.27% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.09% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.82% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.70% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.64% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.77% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.62% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.72% | 96.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.86% | 93.40% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.72% | 92.68% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.87% | 94.73% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.74% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.72% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.69% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.27% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schizocarphus nervosus |
Scoparia dulcis |
PubChem | 129716434 |
LOTUS | LTS0265653 |
wikiData | Q105009149 |