[5,7-Dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] acetate
| Internal ID | 0977b32b-8f21-4a32-944c-d02383ac7fc7 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 6-prenylated flavans > 6-prenylated flavanones |
| IUPAC Name | [5,7-dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] acetate |
| SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OC(C(C2=O)OC(=O)C)C3=CC=CC=C3)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OC(C(C2=O)OC(=O)C)C3=CC=CC=C3)O)C |
| InChI | InChI=1S/C22H22O6/c1-12(2)9-10-15-16(24)11-17-18(19(15)25)20(26)22(27-13(3)23)21(28-17)14-7-5-4-6-8-14/h4-9,11,21-22,24-25H,10H2,1-3H3 |
| InChI Key | PBDWJKUJWZPHNK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
![2D Structure of [5,7-Dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-6-3-methylbut-2-enyl-4-oxo-2-phenyl-23-dihydrochromen-3-yl-acetate.jpg "2D Structure of [5,7-Dihydroxy-6-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.41% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.19% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.26% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.47% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.32% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.94% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.02% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.61% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.08% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.07% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.07% | 99.17% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.98% | 95.64% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.50% | 85.14% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.37% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helichrysum thapsus |
| PubChem | 162937915 |
| LOTUS | LTS0128129 |
| wikiData | Q105205102 |