5,7-Dihydroxy-4'-methoxy-4-phenylcoumarin
| Internal ID | a79e33dd-6a92-4ef6-8c76-ae25645ed36c |
| Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Neoflavones |
| IUPAC Name | 5,7-dihydroxy-4-(4-methoxyphenyl)chromen-2-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)OC3=CC(=CC(=C23)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)OC3=CC(=CC(=C23)O)O |
| InChI | InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)12-8-15(19)21-14-7-10(17)6-13(18)16(12)14/h2-8,17-18H,1H3 |
| InChI Key | RVVQWGLEXIDBKI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.30 |
| LMPK12100032 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.01% | 91.11% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 96.39% | 96.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.31% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.41% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.20% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.53% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.43% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 88.16% | 90.71% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.08% | 93.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.01% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.82% | 90.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.30% | 86.92% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.01% | 93.65% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 86.19% | 95.53% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.05% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.61% | 99.23% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.23% | 81.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.28% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.02% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.26% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Echinops niveus |
| PubChem | 14079929 |
| LOTUS | LTS0078818 |
| wikiData | Q105246347 |