5,7-Dihydroxy-3-[4-hydroxy-3-methyl-2,5-bis(3-methylbut-2-enyl)phenyl]chromen-4-one
| Internal ID | 41945048-2770-4706-86b4-085afdb0ed13 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones > 2-prenylated isoflavones |
| IUPAC Name | 5,7-dihydroxy-3-[4-hydroxy-3-methyl-2,5-bis(3-methylbut-2-enyl)phenyl]chromen-4-one |
| SMILES (Canonical) | CC1=C(C(=CC(=C1CC=C(C)C)C2=COC3=CC(=CC(=C3C2=O)O)O)CC=C(C)C)O |
| SMILES (Isomeric) | CC1=C(C(=CC(=C1CC=C(C)C)C2=COC3=CC(=CC(=C3C2=O)O)O)CC=C(C)C)O |
| InChI | InChI=1S/C26H28O5/c1-14(2)6-8-17-10-20(19(9-7-15(3)4)16(5)25(17)29)21-13-31-23-12-18(27)11-22(28)24(23)26(21)30/h6-7,10-13,27-29H,8-9H2,1-5H3 |
| InChI Key | ZUBXHWGVNFWLBN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-3-[4-hydroxy-3-methyl-2,5-bis(3-methylbut-2-enyl)phenyl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-3-4-hydroxy-3-methyl-25-bis3-methylbut-2-enylphenylchromen-4-one.jpg "2D Structure of 5,7-Dihydroxy-3-[4-hydroxy-3-methyl-2,5-bis(3-methylbut-2-enyl)phenyl]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.84% | 98.95% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.70% | 96.12% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.60% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.24% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.73% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.48% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.88% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.74% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.16% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.15% | 99.23% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.04% | 89.34% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.66% | 97.28% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.54% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 80.02% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Flemingia prostrata |
| PubChem | 162968163 |
| LOTUS | LTS0138600 |
| wikiData | Q105383481 |