5,7-Dihydroxy-2',3',4',5'-tetramethoxyflavone
| Internal ID | 4979fcaf-9bfb-4bed-9f5a-7691a0f43e86 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
| IUPAC Name | 5,7-dihydroxy-2-(2,3,4,5-tetramethoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=C(C(=C(C(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OC)OC)OC |
| SMILES (Isomeric) | COC1=C(C(=C(C(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OC)OC)OC |
| InChI | InChI=1S/C19H18O8/c1-23-15-7-10(17(24-2)19(26-4)18(15)25-3)13-8-12(22)16-11(21)5-9(20)6-14(16)27-13/h5-8,20-21H,1-4H3 |
| InChI Key | ZYVBPTWKKGRSOZ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.10016753 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.00 |
| 206358-02-3 |
| CHEMBL2296064 |
| 5,7-dihydroxy-2-(2,3,4,5-tetramethoxyphenyl)chromen-4-one |
| LMPK12110954 |
| 5,7-Dihydroxy-2-(2,3,4,5-tetramethoxy-phenyl)-1-benzopyran-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 94.53% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.18% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.35% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.93% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.16% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.44% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.04% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.40% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.82% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.77% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.17% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gardenia thailandica |
| Psiadia punctulata |
| PubChem | 5742694 |
| LOTUS | LTS0060957 |
| wikiData | Q105386452 |