[5,7-Dihydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-phenylmethanone
Internal ID | 018c4b06-e0ab-4705-a4ff-aeca2651dbf6 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
IUPAC Name | [5,7-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-phenylmethanone |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C(=C(C=C2O)O)C(=O)C3=CC=CC=C3)C)C |
SMILES (Isomeric) | CC(=CCCC1(C=CC2=C(O1)C(=C(C=C2O)O)C(=O)C3=CC=CC=C3)C)C |
InChI | InChI=1S/C23H24O4/c1-15(2)8-7-12-23(3)13-11-17-18(24)14-19(25)20(22(17)27-23)21(26)16-9-5-4-6-10-16/h4-6,8-11,13-14,24-25H,7,12H2,1-3H3 |
InChI Key | VHBOXYDOVCZHPH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O4 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.78% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.94% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.77% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.73% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.61% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.53% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.22% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.19% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.42% | 90.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.76% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clusia multiflora |
Garcinia vieillardii |
PubChem | 16070714 |
LOTUS | LTS0191860 |
wikiData | Q105286299 |