5,7-Dihydroxy-2-(4-hydroxy-3-methylphenyl)-4h-1-benzopyran-4-one
| Internal ID | 96ea3a46-7785-4ea1-8764-439ddc92f9a6 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3-methylphenyl)chromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O5/c1-8-4-9(2-3-11(8)18)14-7-13(20)16-12(19)5-10(17)6-15(16)21-14/h2-7,17-19H,1H3 |
| InChI Key | UOSZQIQUCYTISS-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.10 |
| 5,7-dihydroxy-2-(4-hydroxy-3-methylphenyl)-4h-1-benzopyran-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.37% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.16% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.87% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.65% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.58% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.47% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.08% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.60% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.81% | 93.65% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.44% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.03% | 86.33% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.25% | 83.57% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.22% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.09% | 90.71% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.41% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arnica acaulis |
| PubChem | 59360007 |
| LOTUS | LTS0073485 |
| wikiData | Q105276565 |