5,7-Dihydroxy-2-[4-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyphenyl]-3-methoxychromen-4-one
| Internal ID | 185b741c-5827-4e5e-a6f9-e4e8b6338b2a |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
| IUPAC Name | 5,7-dihydroxy-2-[4-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyphenyl]-3-methoxychromen-4-one |
| SMILES (Canonical) | COC1=C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)OC4C(C(C(CO4)O)O)O |
| SMILES (Isomeric) | COC1=C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)OC4C(C(C(CO4)O)O)O |
| InChI | InChI=1S/C21H20O11/c1-29-20-17(27)15-11(24)5-9(22)6-14(15)31-19(20)8-2-3-10(23)13(4-8)32-21-18(28)16(26)12(25)7-30-21/h2-6,12,16,18,21-26,28H,7H2,1H3 |
| InChI Key | ASKKBGQVSVTIAW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H20O11 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.10056145 g/mol |
| Topological Polar Surface Area (TPSA) | 175.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-2-[4-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyphenyl]-3-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-2-4-hydroxy-3-345-trihydroxyoxan-2-yloxyphenyl-3-methoxychromen-4-one.jpg "2D Structure of 5,7-Dihydroxy-2-[4-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyphenyl]-3-methoxychromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.35% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.86% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.98% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.70% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.65% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.21% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.78% | 86.33% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 87.82% | 95.53% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.19% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.11% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.36% | 95.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.06% | 99.23% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.92% | 96.12% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.88% | 97.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.57% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 83.49% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.28% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.82% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dacrycarpus dacrydioides |
| PubChem | 74978417 |
| LOTUS | LTS0202574 |
| wikiData | Q104917905 |