(2S)-4-[(2R,8R)-2,8-dihydroxy-9-[(2R,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyheptadecyl]oxolan-2-yl]nonyl]-2-methyl-2H-furan-5-one
Internal ID | c2a7e908-bf50-4071-a645-2b198e874903 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(2R,8R)-2,8-dihydroxy-9-[(2R,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyheptadecyl]oxolan-2-yl]nonyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCC(C(CCC(C1CCC(O1)CC(CCCCCC(CC2=CC(OC2=O)C)O)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC[C@@H]([C@H](CC[C@@H]([C@@H]1CC[C@@H](O1)C[C@@H](CCCCC[C@H](CC2=C[C@@H](OC2=O)C)O)O)O)O)O |
InChI | InChI=1S/C35H64O8/c1-3-4-5-6-7-8-9-10-11-15-18-31(38)32(39)20-21-33(40)34-22-19-30(43-34)25-29(37)17-14-12-13-16-28(36)24-27-23-26(2)42-35(27)41/h23,26,28-34,36-40H,3-22,24-25H2,1-2H3/t26-,28+,29+,30+,31-,32-,33-,34-/m0/s1 |
InChI Key | ZPRYGZNEAVBQEP-VQVLAIFTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H64O8 |
Molecular Weight | 612.90 g/mol |
Exact Mass | 612.46011900 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 7.40 |
There are no found synonyms. |
![2D Structure of (2S)-4-[(2R,8R)-2,8-dihydroxy-9-[(2R,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyheptadecyl]oxolan-2-yl]nonyl]-2-methyl-2H-furan-5-one 2D Structure of (2S)-4-[(2R,8R)-2,8-dihydroxy-9-[(2R,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyheptadecyl]oxolan-2-yl]nonyl]-2-methyl-2H-furan-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/56fe3810-857d-11ee-ad9c-194ba4c98d65.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.18% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.64% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.88% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.94% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.88% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.15% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.54% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.36% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.04% | 92.08% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.66% | 85.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.42% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.45% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.12% | 95.89% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.86% | 97.29% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.76% | 92.88% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.35% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.21% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.77% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona muricata |
PubChem | 163003296 |
LOTUS | LTS0016303 |
wikiData | Q105381151 |