2-[(3R,6S,9R,10R,13R,16S)-6-(3-amino-3-oxopropyl)-9-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2S)-2-[[(2S)-1-[3-(4-bromophenyl)-2-[[(2R)-2-formamidopropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3,3-dimethylbutanoyl]amino]-3,3-dimethylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfopropanoyl]amino]-7,10-dimethyl-2,5,8,12,15-pentaoxo-3-propan-2-yl-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-13-yl]acetic acid
| Internal ID | ed658686-65ac-47dc-b5ff-e64d368913b7 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 2-[(3R,6S,9R,10R,13R,16S)-6-(3-amino-3-oxopropyl)-9-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2S)-2-[[(2S)-1-[3-(4-bromophenyl)-2-[[(2R)-2-formamidopropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3,3-dimethylbutanoyl]amino]-3,3-dimethylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfopropanoyl]amino]-7,10-dimethyl-2,5,8,12,15-pentaoxo-3-propan-2-yl-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-13-yl]acetic acid |
| SMILES (Canonical) | CCC(C)(C)C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS(=O)(=O)O)C(=O)NC3C(OC(=O)C(NC(=O)C4CCCN4C(=O)C(NC(=O)C(N(C3=O)C)CCC(=O)N)C(C)C)CC(=O)O)C)NC(=O)C(C(C)(C)C)NC(=O)C5CCCN5C(=O)C(C(C6=CC=C(C=C6)Br)O)NC(=O)C(C)NC=O |
| SMILES (Isomeric) | CCC(C)(C)[C@H](C(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](CS(=O)(=O)O)C(=O)N[C@@H]3[C@H](OC(=O)[C@H](NC(=O)[C@@H]4CCCN4C(=O)[C@H](NC(=O)[C@@H](N(C3=O)C)CCC(=O)N)C(C)C)CC(=O)O)C)NC(=O)[C@H](C(C)(C)C)NC(=O)[C@@H]5CCCN5C(=O)C(C(C6=CC=C(C=C6)Br)O)NC(=O)[C@@H](C)NC=O |
| InChI | InChI=1S/C75H109BrN18O22S/c1-12-75(9,10)59(91-67(107)58(74(6,7)8)90-66(106)51-22-17-31-94(51)71(111)56(89-60(100)38(4)82-36-95)57(99)40-23-25-42(76)26-24-40)68(108)84-46(32-41-34-81-44-19-14-13-18-43(41)44)62(102)83-45(20-15-29-80-73(78)79)61(101)86-48(35-117(113,114)115)63(103)88-55-39(5)116-72(112)47(33-53(97)98)85-65(105)50-21-16-30-93(50)70(110)54(37(2)3)87-64(104)49(27-28-52(77)96)92(11)69(55)109/h13-14,18-19,23-26,34,36-39,45-51,54-59,81,99H,12,15-17,20-22,27-33,35H2,1-11H3,(H2,77,96)(H,82,95)(H,83,102)(H,84,108)(H,85,105)(H,86,101)(H,87,104)(H,88,103)(H,89,100)(H,90,106)(H,91,107)(H,97,98)(H4,78,79,80)(H,113,114,115)/t38-,39-,45+,46-,47-,48-,49+,50+,51+,54-,55-,56?,57?,58-,59+/m1/s1 |
| InChI Key | GUGALNGMVNRENE-MXBNAZQTSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C75H109BrN18O22S |
| Molecular Weight | 1726.70 g/mol |
| Exact Mass | 1724.68679 g/mol |
| Topological Polar Surface Area (TPSA) | 622.00 Ų |
| XlogP | -0.30 |
| Atomic LogP (AlogP) | -2.72 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 35 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7938 | 79.38% |
| Caco-2 | - | 0.8622 | 86.22% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.7429 | 74.29% |
| Subcellular localzation | Lysosomes | 0.5177 | 51.77% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7990 | 79.90% |
| OATP1B3 inhibitior | + | 0.9283 | 92.83% |
| MATE1 inhibitior | - | 0.7009 | 70.09% |
| OCT2 inhibitior | - | 0.7000 | 70.00% |
| BSEP inhibitior | + | 0.9683 | 96.83% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8730 | 87.30% |
| CYP3A4 substrate | + | 0.7654 | 76.54% |
| CYP2C9 substrate | - | 0.6073 | 60.73% |
| CYP2D6 substrate | - | 0.8417 | 84.17% |
| CYP3A4 inhibition | - | 0.6694 | 66.94% |
| CYP2C9 inhibition | - | 0.6957 | 69.57% |
| CYP2C19 inhibition | - | 0.6517 | 65.17% |
| CYP2D6 inhibition | - | 0.8454 | 84.54% |
| CYP1A2 inhibition | - | 0.6912 | 69.12% |
| CYP2C8 inhibition | + | 0.8578 | 85.78% |
| CYP inhibitory promiscuity | - | 0.8186 | 81.86% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | + | 0.5100 | 51.00% |
| Carcinogenicity (trinary) | Non-required | 0.5605 | 56.05% |
| Eye corrosion | - | 0.9757 | 97.57% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.7554 | 75.54% |
| Skin corrosion | - | 0.9080 | 90.80% |
| Ames mutagenesis | - | 0.6900 | 69.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7080 | 70.80% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | - | 0.5527 | 55.27% |
| skin sensitisation | - | 0.8250 | 82.50% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.6125 | 61.25% |
| Nephrotoxicity | - | 0.8562 | 85.62% |
| Acute Oral Toxicity (c) | III | 0.5754 | 57.54% |
| Estrogen receptor binding | - | 0.5718 | 57.18% |
| Androgen receptor binding | + | 0.7421 | 74.21% |
| Thyroid receptor binding | + | 0.8186 | 81.86% |
| Glucocorticoid receptor binding | + | 0.8484 | 84.84% |
| Aromatase binding | + | 0.8305 | 83.05% |
| PPAR gamma | + | 0.7769 | 77.69% |
| Honey bee toxicity | - | 0.6050 | 60.50% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.9841 | 98.41% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 99.98% | 96.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.40% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.35% | 97.64% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.34% | 98.33% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 99.31% | 94.66% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 99.29% | 95.56% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 99.25% | 92.12% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 99.17% | 96.76% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.93% | 90.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.71% | 96.61% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 97.61% | 99.23% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.50% | 88.42% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.11% | 95.38% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.05% | 82.38% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 97.04% | 95.92% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.81% | 85.14% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 95.84% | 99.52% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.60% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.39% | 96.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.38% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.29% | 99.23% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 95.20% | 97.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.20% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.90% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.89% | 94.75% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 94.88% | 97.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.22% | 95.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.19% | 92.97% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.08% | 95.89% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.77% | 97.23% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.45% | 98.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 93.44% | 90.93% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.38% | 88.56% |
| CHEMBL5028 | O14672 | ADAM10 | 92.68% | 97.50% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.37% | 89.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.98% | 96.90% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.00% | 93.03% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.80% | 91.81% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.58% | 94.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.52% | 100.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 89.96% | 96.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.43% | 99.17% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.24% | 96.85% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 89.00% | 97.29% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.77% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.54% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.74% | 97.14% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.69% | 95.69% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.50% | 89.63% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.35% | 95.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.31% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.26% | 96.00% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 86.11% | 92.22% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 85.55% | 92.38% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.05% | 96.11% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.93% | 97.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.74% | 95.56% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 83.11% | 98.44% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.85% | 98.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.01% | 99.18% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.21% | 82.50% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.57% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.35% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 155802073 |
| LOTUS | LTS0224709 |
| wikiData | Q104203128 |