(1S,5S,6S,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione
Internal ID | b88a94da-65c8-4be2-99b8-b12e2ab4a860 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (1S,5S,6S,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione |
SMILES (Canonical) | CC12CC(OC13CC(C4C2CC5CC4C(=O)O5)OC3=O)C6=COC=C6 |
SMILES (Isomeric) | C[C@@]12CC(O[C@@]13C[C@@H]([C@H]4[C@@H]2C[C@@H]5C[C@@H]4C(=O)O5)OC3=O)C6=COC=C6 |
InChI | InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3/t10-,11-,12-,13?,14-,15+,18-,19+/m0/s1 |
InChI Key | QEANLIISUSNNDX-MHYBFSGXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 75.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of (1S,5S,6S,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione 2D Structure of (1S,5S,6S,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione](https://plantaedb.com/storage/docs/compounds/2023/11/56a101e0-855d-11ee-a7d2-8952ab872315.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.88% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.42% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.20% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.79% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.79% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.71% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.81% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.98% | 93.40% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 85.96% | 92.51% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.84% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.60% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.82% | 97.14% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.63% | 91.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.67% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.65% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.43% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.57% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 137705757 |
LOTUS | LTS0169415 |
wikiData | Q105219083 |