(6aS)-4-hydroxy-3-methyl-8-[(E)-prop-1-enyl]-6a,7-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione
| Internal ID | a95d8c61-5784-49ed-b570-bebb21e559a6 |
| Taxonomy | Organoheterocyclic compounds > Benzodiazepines > 1,4-benzodiazepines |
| IUPAC Name | (6aS)-4-hydroxy-3-methyl-8-[(E)-prop-1-enyl]-6a,7-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES (Canonical) | CC=CC1=CN2C(C1)C(=O)NC3=C(C2=O)C=CC(=C3O)C |
| SMILES (Isomeric) | C/C=C/C1=CN2[C@@H](C1)C(=O)NC3=C(C2=O)C=CC(=C3O)C |
| InChI | InChI=1S/C16H16N2O3/c1-3-4-10-7-12-15(20)17-13-11(16(21)18(12)8-10)6-5-9(2)14(13)19/h3-6,8,12,19H,7H2,1-2H3,(H,17,20)/b4-3+/t12-/m0/s1 |
| InChI Key | QVMOQPKRVNMMQP-PCAWENJQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.11609238 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.85% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.56% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.40% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.07% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.93% | 89.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 88.67% | 90.93% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.62% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.55% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.40% | 97.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.10% | 93.03% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.89% | 93.40% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.49% | 99.23% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.78% | 96.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.49% | 100.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.38% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.03% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102449829 |
| LOTUS | LTS0126838 |
| wikiData | Q105228750 |