5,6,9-trihydroxy-3,5,6,7-tetrahydro-1H-benzo[f][2]benzofuran-8-one
Internal ID | 75312ce0-9455-4144-8427-efe7120a2066 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | 5,6,9-trihydroxy-3,5,6,7-tetrahydro-1H-benzo[f][2]benzofuran-8-one |
SMILES (Canonical) | C1C(C(C2=C(C1=O)C(=C3COCC3=C2)O)O)O |
SMILES (Isomeric) | C1C(C(C2=C(C1=O)C(=C3COCC3=C2)O)O)O |
InChI | InChI=1S/C12H12O5/c13-8-2-9(14)11(15)6-1-5-3-17-4-7(5)12(16)10(6)8/h1,9,11,14-16H,2-4H2 |
InChI Key | KVULUBRLURDGGV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H12O5 |
Molecular Weight | 236.22 g/mol |
Exact Mass | 236.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.06% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.72% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.48% | 94.45% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.12% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.03% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.33% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.89% | 95.56% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.97% | 85.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.97% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.51% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.00% | 93.40% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.87% | 83.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.79% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.26% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.27% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.18% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aquilaria sinensis |
PubChem | 75215336 |
LOTUS | LTS0150463 |
wikiData | Q104990779 |