5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-ol
Internal ID | 3247eb24-5402-4150-9c4d-db31a16d5f3a |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-ol |
SMILES (Canonical) | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1C)O)OC)OC)OC)OC)OCO3 |
SMILES (Isomeric) | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1C)O)OC)OC)OC)OC)OCO3 |
InChI | InChI=1S/C23H28O7/c1-11-7-13-8-16-21(30-10-29-16)22(27-5)17(13)18-14(19(24)12(11)2)9-15(25-3)20(26-4)23(18)28-6/h8-9,11-12,19,24H,7,10H2,1-6H3 |
InChI Key | GWDFJIBHVSYXQL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28O7 |
Molecular Weight | 416.50 g/mol |
Exact Mass | 416.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 75.60 Ų |
XlogP | 4.00 |
GWDFJIBHVSYXQL-UHFFFAOYSA-N |
FT-0775815 |
FT-0775816 |
1,2,3,13-Tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-ol # |
![2D Structure of 5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-ol 2D Structure of 5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/5678-tetrahydro-12313-tetramethoxy-67-dimethylbenzo34cycloocta12-f13benzodioxol-5-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 94.60% | 96.76% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 91.88% | 82.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.46% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.44% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.39% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.91% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.73% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.34% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.80% | 95.56% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.45% | 89.50% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 85.29% | 96.86% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.66% | 94.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.35% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.92% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.40% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.00% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.08% | 97.25% |
CHEMBL2535 | P11166 | Glucose transporter | 80.92% | 98.75% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.47% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schisandra arisanensis |
Schisandra chinensis |
Schisandra rubriflora |
PubChem | 634472 |
LOTUS | LTS0133881 |
wikiData | Q105022239 |