8-[2-(4-Hydroxyphenyl)ethyl]-15-[3-(4-hydroxyphenyl)propyl]-18-(6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl)-1,5,12,19-tetramethyl-2-methylidene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptazacyclopentacosane-11,22-dicarboxylic acid
| Internal ID | 361a50aa-15c8-48ee-86e7-ee0075820a81 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 8-[2-(4-hydroxyphenyl)ethyl]-15-[3-(4-hydroxyphenyl)propyl]-18-(6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl)-1,5,12,19-tetramethyl-2-methylidene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptazacyclopentacosane-11,22-dicarboxylic acid |
| SMILES (Canonical) | CC1C(NC(=O)C(NC(=O)C(C(NC(=O)C(NC(=O)C(NC(=O)C(=C)N(C(=O)CCC(NC1=O)C(=O)O)C)C)CCC2=CC=C(C=C2)O)C(=O)O)C)CCCC3=CC=C(C=C3)O)C=CC(=CC(C)C(CC4=CC=CC=C4)OC)C |
| SMILES (Isomeric) | CC1C(NC(=O)C(NC(=O)C(C(NC(=O)C(NC(=O)C(NC(=O)C(=C)N(C(=O)CCC(NC1=O)C(=O)O)C)C)CCC2=CC=C(C=C2)O)C(=O)O)C)CCCC3=CC=C(C=C3)O)C=CC(=CC(C)C(CC4=CC=CC=C4)OC)C |
| InChI | InChI=1S/C58H75N7O14/c1-33(31-34(2)48(79-8)32-41-13-10-9-11-14-41)17-27-44-35(3)51(69)63-47(57(75)76)29-30-49(68)65(7)38(6)54(72)59-37(5)53(71)62-46(28-22-40-20-25-43(67)26-21-40)56(74)64-50(58(77)78)36(4)52(70)61-45(55(73)60-44)16-12-15-39-18-23-42(66)24-19-39/h9-11,13-14,17-21,23-27,31,34-37,44-48,50,66-67H,6,12,15-16,22,28-30,32H2,1-5,7-8H3,(H,59,72)(H,60,73)(H,61,70)(H,62,71)(H,63,69)(H,64,74)(H,75,76)(H,77,78) |
| InChI Key | NNMCUUKHSDLGJQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C58H75N7O14 |
| Molecular Weight | 1094.30 g/mol |
| Exact Mass | 1093.53720009 g/mol |
| Topological Polar Surface Area (TPSA) | 319.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.94% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.68% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 97.36% | 91.71% |
| CHEMBL4072 | P07858 | Cathepsin B | 96.60% | 93.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.15% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.70% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.58% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.77% | 91.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.13% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.73% | 99.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.94% | 91.49% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.53% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.52% | 95.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.00% | 97.64% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.83% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.22% | 90.71% |
| CHEMBL233 | P35372 | Mu opioid receptor | 85.70% | 97.93% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.36% | 97.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.48% | 95.34% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.08% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.44% | 90.20% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.90% | 93.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.32% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.80% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.44% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162815676 |
| LOTUS | LTS0102011 |
| wikiData | Q104179805 |