5,6,3'-Trihydroxy-3,7,8,4'-tetramethoxyflavone
| Internal ID | be49505c-856c-40b3-a5b6-5f0d379e2e93 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | 5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7,8-trimethoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C(=C3O2)OC)OC)O)O)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C(=C3O2)OC)OC)O)O)OC)O |
| InChI | InChI=1S/C19H18O9/c1-24-10-6-5-8(7-9(10)20)15-17(25-2)13(22)11-12(21)14(23)18(26-3)19(27-4)16(11)28-15/h5-7,20-21,23H,1-4H3 |
| InChI Key | AHABJNGVCRMRMN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.09508215 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 2.80 |
| CHEBI:196382 |
| LMPK12113337 |
| 5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7,8-trimethoxychromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.20% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.04% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.30% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.24% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.66% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.33% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.78% | 95.56% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.45% | 98.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.38% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.30% | 99.17% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.35% | 95.53% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.20% | 90.20% |
| CHEMBL3194 | P02766 | Transthyretin | 83.77% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.30% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.10% | 95.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.96% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calycadenia fremontii |
| PubChem | 44260068 |
| LOTUS | LTS0130847 |
| wikiData | Q104912145 |