5,6-Dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4,17-diol
| Internal ID | 3d703030-accf-4468-871b-1053ce341a6d |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Homoerythrinane alkaloids |
| IUPAC Name | 5,6-dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4,17-diol |
| SMILES (Canonical) | COC1=C2CCCN3CCC4=CCC(CC43C2=CC(=C1OC)O)O |
| SMILES (Isomeric) | COC1=C2CCCN3CCC4=CCC(CC43C2=CC(=C1OC)O)O |
| InChI | InChI=1S/C19H25NO4/c1-23-17-14-4-3-8-20-9-7-12-5-6-13(21)11-19(12,20)15(14)10-16(22)18(17)24-2/h5,10,13,21-22H,3-4,6-9,11H2,1-2H3 |
| InChI Key | OQMVSCHTEYJJII-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of 5,6-Dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4,17-diol](https://plantaedb.com/storage/docs/compounds/2023/11/56-dimethoxy-11-azatetracyclo9700114027octadeca-24614-tetraene-417-diol.jpg "2D Structure of 5,6-Dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene-4,17-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.15% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.55% | 93.40% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.33% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.63% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.17% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.16% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.78% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.63% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.77% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.65% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.62% | 86.33% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.12% | 95.62% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.25% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.76% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.56% | 99.15% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.05% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phelline comosa |
| PubChem | 14605242 |
| LOTUS | LTS0058059 |
| wikiData | Q105197016 |