5,6-Dihydroxyindole
| Internal ID | bdeb6539-bb13-4905-a2f3-d58e80c31b4d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Hydroxyindoles |
| IUPAC Name | 1H-indole-5,6-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9-11H |
| InChI Key | SGNZYJXNUURYCH-UHFFFAOYSA-N |
| Popularity | 630 references in papers |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.047678466 g/mol |
| Topological Polar Surface Area (TPSA) | 56.30 Ų |
| XlogP | 1.30 |
| 3131-52-0 |
| 1H-Indole-5,6-diol |
| Dopamine lutine |
| dhi |
| 5,6-dihydroxy indole |
| MFCD00798933 |
| CHEMBL92636 |
| Z3OC8499KG |
| CHEBI:27404 |
| 5,6-Dihydroxy-1H-indole |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.67% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.87% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.49% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.04% | 83.10% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.04% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.08% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.07% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.84% | 91.49% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.79% | 94.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.68% | 92.94% |
| CHEMBL5485 | P14920 | D-amino-acid oxidase | 80.12% | 96.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 114683 |
| LOTUS | LTS0147291 |
| wikiData | Q9207472 |