5,6-dihydroxy-7,8-dimethoxy-2-[(E)-2-phenylethenyl]pyrano[2,3-b][1]benzofuran-4-one
Internal ID | 957d5ba1-dc0f-49e9-b131-a8f7875ace4c |
Taxonomy | Organoheterocyclic compounds > Furopyrans |
IUPAC Name | 5,6-dihydroxy-7,8-dimethoxy-2-[(E)-2-phenylethenyl]pyrano[2,3-b][1]benzofuran-4-one |
SMILES (Canonical) | COC1=C(C(=C2C3=C(OC(=CC3=O)C=CC4=CC=CC=C4)OC2=C1OC)O)O |
SMILES (Isomeric) | COC1=C(C(=C2C3=C(OC(=CC3=O)/C=C/C4=CC=CC=C4)OC2=C1OC)O)O |
InChI | InChI=1S/C21H16O7/c1-25-19-17(24)16(23)15-14-13(22)10-12(9-8-11-6-4-3-5-7-11)27-21(14)28-18(15)20(19)26-2/h3-10,23-24H,1-2H3/b9-8+ |
InChI Key | QXEBIXCIMOCZGN-CMDGGOBGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H16O7 |
Molecular Weight | 380.30 g/mol |
Exact Mass | 380.08960285 g/mol |
Topological Polar Surface Area (TPSA) | 98.40 Ų |
XlogP | 3.80 |
There are no found synonyms. |
![2D Structure of 5,6-dihydroxy-7,8-dimethoxy-2-[(E)-2-phenylethenyl]pyrano[2,3-b][1]benzofuran-4-one 2D Structure of 5,6-dihydroxy-7,8-dimethoxy-2-[(E)-2-phenylethenyl]pyrano[2,3-b][1]benzofuran-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/56-dihydroxy-78-dimethoxy-2-e-2-phenylethenylpyrano23-b1benzofuran-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.81% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.82% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.12% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.17% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.03% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.88% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 86.88% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.57% | 89.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.43% | 94.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.64% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.07% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.65% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Didymocarpus albicalyx |
PubChem | 10667459 |
LOTUS | LTS0228371 |
wikiData | Q105229551 |