5,6-Dihydroxy-3,3',4',7-tetramethoxyflavone
Internal ID | 4e8485cb-f978-4d28-bb5b-08a5aa6d52b4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6-dihydroxy-3,7-dimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)O)O)OC)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)O)O)OC)OC |
InChI | InChI=1S/C19H18O8/c1-23-10-6-5-9(7-11(10)24-2)18-19(26-4)17(22)14-12(27-18)8-13(25-3)15(20)16(14)21/h5-8,20-21H,1-4H3 |
InChI Key | DXEKSOHHLFZGKA-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H18O8 |
Molecular Weight | 374.30 g/mol |
Exact Mass | 374.10016753 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 3.10 |
5,6-dihydroxy-3,7,3',4'-tetramethoxyflavone |
5,6-Dihydroxy-3,3',4',7-tetramethoxyflavone |
LMPK12113012 |
AKOS040762739 |
63296-15-1 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.69% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.55% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.86% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.92% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.73% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.98% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.10% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.52% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.48% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.11% | 90.20% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 83.23% | 85.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.99% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.59% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.28% | 90.71% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.20% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aster himalaicus |
Distemonanthus benthamianus |
Pulicaria sicula |
PubChem | 14376225 |
LOTUS | LTS0082102 |
wikiData | Q104990972 |