5,6-dihydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one
| Internal ID | 92127d83-0910-4d33-ba29-754e7c760441 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 5,6-dihydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES (Canonical) | CC1(C=CC2=C3C(=C(C(=C2O1)O)O)C(=O)C4=CC=CC=C4N3)C |
| SMILES (Isomeric) | CC1(C=CC2=C3C(=C(C(=C2O1)O)O)C(=O)C4=CC=CC=C4N3)C |
| InChI | InChI=1S/C18H15NO4/c1-18(2)8-7-10-13-12(15(21)16(22)17(10)23-18)14(20)9-5-3-4-6-11(9)19-13/h3-8,21-22H,1-2H3,(H,19,20) |
| InChI Key | ZCDADHSGVUIMFD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 78.80 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 5,6-dihydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/56-dihydroxy-33-dimethyl-12h-pyrano23-cacridin-7-one.jpg "2D Structure of 5,6-dihydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.92% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.25% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.82% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.60% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.37% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.38% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.09% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.77% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.60% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.05% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.15% | 99.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.93% | 88.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.67% | 85.14% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.77% | 95.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.24% | 98.59% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.79% | 90.08% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.24% | 94.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.17% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.95% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |
| PubChem | 163011685 |
| LOTUS | LTS0194286 |
| wikiData | Q105371039 |