2-[[4,5-Dihydroxy-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol
Internal ID | 3b18d0ae-2c22-4f1e-a6ae-d10757d612b9 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[[4,5-dihydroxy-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)COC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(C(O9)C)O)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)COC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(C(O9)C)O)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C45H74O16/c1-19-9-14-45(55-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)58-42-38(53)35(50)39(60-41-37(52)34(49)32(47)22(4)57-41)29(59-42)18-54-40-36(51)33(48)31(46)21(3)56-40/h19-42,46-53H,7-18H2,1-6H3 |
InChI Key | BWYAGTYHXROECV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H74O16 |
Molecular Weight | 871.10 g/mol |
Exact Mass | 870.49768627 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.09% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.51% | 97.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.69% | 89.05% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.06% | 97.31% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.03% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.07% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.87% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.68% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.63% | 96.61% |
CHEMBL204 | P00734 | Thrombin | 88.94% | 96.01% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.74% | 91.49% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.80% | 96.77% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.65% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.43% | 92.94% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.11% | 92.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.90% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.50% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.48% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.47% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.83% | 97.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.75% | 97.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.78% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.59% | 92.86% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.05% | 95.58% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.97% | 96.43% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.37% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.58% | 96.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.57% | 92.62% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.56% | 93.04% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 81.16% | 97.78% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.72% | 95.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.72% | 96.38% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.30% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus racemosus |
PubChem | 163053057 |
LOTUS | LTS0134355 |
wikiData | Q104947781 |