5,5,9-Trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,14-dione
| Internal ID | 2450b304-8c3a-4632-a435-62f8c2911b58 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Cyclic ketones |
| IUPAC Name | 5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,14-dione |
| SMILES (Canonical) | CC1(C2CCC34CC(CCC3C2(CCC1=O)C)C(=O)C4)C |
| SMILES (Isomeric) | CC1(C2CCC34CC(CCC3C2(CCC1=O)C)C(=O)C4)C |
| InChI | InChI=1S/C19H28O2/c1-17(2)14-6-9-19-10-12(13(20)11-19)4-5-15(19)18(14,3)8-7-16(17)21/h12,14-15H,4-11H2,1-3H3 |
| InChI Key | HKCBAZAJDJFSES-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.208930132 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of 5,5,9-Trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,14-dione](https://plantaedb.com/storage/docs/compounds/2023/11/559-trimethyltetracyclo11210110049hexadecane-614-dione.jpg "2D Structure of 5,5,9-Trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,14-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.24% | 96.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.34% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.90% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.50% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.78% | 95.38% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.10% | 82.69% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.19% | 96.09% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.87% | 85.30% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.68% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.58% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.31% | 91.11% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.27% | 93.04% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.29% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Callicarpa furfuracea |
| PubChem | 73811225 |
| LOTUS | LTS0065282 |
| wikiData | Q105029581 |