3-[4,5-Dihydroxy-2-(6-methyl-4-oxopyran-2-yl)phenyl]-6-[2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxypyran-2-one
| Internal ID | fa25914a-f0d3-4bc0-8089-ad36b2ae716b |
| Taxonomy | Benzenoids > Phenols > Benzenediols > Catechols |
| IUPAC Name | 3-[4,5-dihydroxy-2-(6-methyl-4-oxopyran-2-yl)phenyl]-6-[2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxypyran-2-one |
| SMILES (Canonical) | CC1=CC(=O)C=C(O1)C2=CC(=C(C=C2C3=C(C=C(OC3=O)C=CC4=CC(=C(C=C4)O)O)O)O)O |
| SMILES (Isomeric) | CC1=CC(=O)C=C(O1)C2=CC(=C(C=C2C3=C(C=C(OC3=O)C=CC4=CC(=C(C=C4)O)O)O)O)O |
| InChI | InChI=1S/C25H18O9/c1-12-6-14(26)8-23(33-12)16-10-20(29)21(30)11-17(16)24-22(31)9-15(34-25(24)32)4-2-13-3-5-18(27)19(28)7-13/h2-11,27-31H,1H3 |
| InChI Key | WJHRLIAIIVRKTD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H18O9 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.09508215 g/mol |
| Topological Polar Surface Area (TPSA) | 154.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.91% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.24% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.87% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.97% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 93.80% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.16% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.35% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.01% | 99.15% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.01% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.82% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.57% | 90.71% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.18% | 80.78% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.86% | 91.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.67% | 93.65% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.02% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76171728 |
| LOTUS | LTS0127245 |
| wikiData | Q104200270 |