[17-Acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[4-hydroxy-5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] acetate
Internal ID | be8babcc-6690-4991-97d3-958741748b08 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [17-acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[4-hydroxy-5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] acetate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C6CC(C7(C(CCC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)OC(=O)C)C)C)C)OC)O |
SMILES (Isomeric) | CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C6CC(C7(C(CCC7(C6(CC=C5C4)O)O)(C(=O)C)O)C)OC(=O)C)C)C)C)OC)O |
InChI | InChI=1S/C42H66O16/c1-20-35(47)29(51-8)18-34(52-20)58-37-22(3)54-33(17-28(37)46)57-36-21(2)53-32(16-27(36)45)56-26-10-11-38(6)25(15-26)9-12-41(49)30(38)19-31(55-24(5)44)39(7)40(48,23(4)43)13-14-42(39,41)50/h9,20-22,26-37,45-50H,10-19H2,1-8H3 |
InChI Key | OQIBAKBNODPWBP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H66O16 |
Molecular Weight | 827.00 g/mol |
Exact Mass | 826.43508601 g/mol |
Topological Polar Surface Area (TPSA) | 229.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of [17-Acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[4-hydroxy-5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] acetate 2D Structure of [17-Acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[4-hydroxy-5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/551e5a20-83b1-11ee-8ea5-0b3b8768b117.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.17% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.01% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.66% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.65% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.48% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.03% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.91% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.89% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.61% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.35% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.60% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.42% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.27% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.00% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.54% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.42% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 81.80% | 97.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.59% | 89.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.11% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias incarnata |
PubChem | 162870940 |
LOTUS | LTS0217467 |
wikiData | Q105196835 |