8-Hydroxy-4-methyl-3,11-dioxa-15-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),4,8,12-pentaene-6,14-dione
| Internal ID | e09448ae-571f-48a2-92a4-8640e5f6a067 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 8-hydroxy-4-methyl-3,11-dioxa-15-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),4,8,12-pentaene-6,14-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H13NO5/c1-7-4-10(18)14-11(19)5-12-13(15(14)22-7)8-2-3-17-16(20)9(8)6-21-12/h4-6,8,19H,2-3H2,1H3,(H,17,20) |
| InChI Key | OAQHRJFPPJOCJD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 84.90 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 8-Hydroxy-4-methyl-3,11-dioxa-15-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),4,8,12-pentaene-6,14-dione](https://plantaedb.com/storage/docs/compounds/2023/11/551a7630-8682-11ee-b003-813a6936f7a5.jpg "2D Structure of 8-Hydroxy-4-methyl-3,11-dioxa-15-azatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),4,8,12-pentaene-6,14-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.72% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.34% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.19% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.07% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.66% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.51% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.37% | 93.04% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.08% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.84% | 94.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.74% | 100.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.32% | 91.38% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.02% | 93.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.96% | 94.45% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.83% | 92.94% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.49% | 85.11% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.39% | 86.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.62% | 94.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.29% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schumanniophyton magnificum |
| PubChem | 9994888 |
| LOTUS | LTS0121347 |
| wikiData | Q105188775 |