5,5'-Sulfanediylbis[4-(4-methoxyphenyl)-1-methyl-1H-imidazol-2-amine]
| Internal ID | 74726a44-3853-4966-8b8a-dc2fdc1271a8 |
| Taxonomy | Organoheterocyclic compounds > Azoles > Imidazoles > Substituted imidazoles > Phenylimidazoles |
| IUPAC Name | 5-[2-amino-5-(4-methoxyphenyl)-3-methylimidazol-4-yl]sulfanyl-4-(4-methoxyphenyl)-1-methylimidazol-2-amine |
| SMILES (Canonical) | CN1C(=C(N=C1N)C2=CC=C(C=C2)OC)SC3=C(N=C(N3C)N)C4=CC=C(C=C4)OC |
| SMILES (Isomeric) | CN1C(=C(N=C1N)C2=CC=C(C=C2)OC)SC3=C(N=C(N3C)N)C4=CC=C(C=C4)OC |
| InChI | InChI=1S/C22H24N6O2S/c1-27-19(17(25-21(27)23)13-5-9-15(29-3)10-6-13)31-20-18(26-22(24)28(20)2)14-7-11-16(30-4)12-8-14/h5-12H,1-4H3,(H2,23,25)(H2,24,26) |
| InChI Key | MFYQKLYRRCYHIK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.16814520 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | 3.40 |
| 5,5'-Sulfanediylbis[4-(4-methoxyphenyl)-1-methyl-1H-imidazol-2-amine] |
| DTXSID60582918 |
![2D Structure of 5,5'-Sulfanediylbis[4-(4-methoxyphenyl)-1-methyl-1H-imidazol-2-amine]](https://plantaedb.com/storage/docs/compounds/2023/11/55-sulfanediylbis4-4-methoxyphenyl-1-methyl-1h-imidazol-2-amine.jpg "2D Structure of 5,5'-Sulfanediylbis[4-(4-methoxyphenyl)-1-methyl-1H-imidazol-2-amine]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.87% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.06% | 86.33% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.71% | 97.53% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.10% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.07% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.11% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.21% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.16% | 90.17% |
| CHEMBL2487 | P05067 | Beta amyloid A4 protein | 85.95% | 96.74% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.99% | 100.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.50% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.28% | 98.95% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.14% | 95.12% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 83.75% | 94.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.54% | 95.93% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.38% | 81.11% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.19% | 96.67% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.10% | 92.68% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.29% | 94.42% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.27% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16104600 |
| LOTUS | LTS0100002 |
| wikiData | Q82474426 |