(1S,9R,11R,12R,15S,16S)-15-[(1S)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-12,15-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.03,9.012,16]octadeca-2,4-dien-7-one
Internal ID | ed342b7c-ea31-46a6-912d-544b5b0b74c3 |
Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives > Dihydropyranones |
IUPAC Name | (1S,9R,11R,12R,15S,16S)-15-[(1S)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-12,15-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.03,9.012,16]octadeca-2,4-dien-7-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2(CCC3(C2(CCC4C3CC5C(=C4C)C=CCC(=O)O5)C)O)O)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@@]2(CC[C@@]3([C@@]2(CC[C@H]4[C@H]3C[C@@H]5C(=C4C)C=CCC(=O)O5)C)O)O)O)C |
InChI | InChI=1S/C28H38O7/c1-15-13-22(35-24(30)16(15)2)26(5,31)28(33)12-11-27(32)20-14-21-19(7-6-8-23(29)34-21)17(3)18(20)9-10-25(27,28)4/h6-7,18,20-22,31-33H,8-14H2,1-5H3/t18-,20-,21-,22-,25+,26+,27-,28+/m1/s1 |
InChI Key | IPKOELXELPUFEK-OTUIKDRCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H38O7 |
Molecular Weight | 486.60 g/mol |
Exact Mass | 486.26175355 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.57% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.86% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.31% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.46% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.42% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.64% | 99.23% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.15% | 82.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.77% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.90% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.28% | 89.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.81% | 93.04% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.42% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.52% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.77% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.49% | 94.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.72% | 95.38% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.30% | 85.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.00% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.94% | 97.79% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.63% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.53% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis peruviana |
PubChem | 163099577 |
LOTUS | LTS0260748 |
wikiData | Q105117297 |