[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate
Internal ID | c46cff66-adc8-4e1f-afeb-457dd9ecbe9a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides > Steviol glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
SMILES (Canonical) | CC12CCCC(C1CCC34C2C(CC(C3)C(=C)C4=O)O)(C)C(=O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | CC12CCCC(C1CCC34C2C(CC(C3)C(=C)C4=O)O)(C)C(=O)OC5C(C(C(C(O5)CO)O)O)O |
InChI | InChI=1S/C26H38O9/c1-12-13-9-14(28)20-24(2)6-4-7-25(3,16(24)5-8-26(20,10-13)21(12)32)23(33)35-22-19(31)18(30)17(29)15(11-27)34-22/h13-20,22,27-31H,1,4-11H2,2-3H3 |
InChI Key | JSKLOHJUYDOADP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H38O9 |
Molecular Weight | 494.60 g/mol |
Exact Mass | 494.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 154.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.96% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.94% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.40% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.36% | 97.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.71% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.35% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 87.39% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.39% | 93.04% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.40% | 95.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.97% | 95.38% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.94% | 96.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.54% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.40% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.38% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.53% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.45% | 94.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.33% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.15% | 95.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.00% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.48% | 96.21% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.09% | 90.08% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.64% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.18% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adenostemma viscosum |
Pteris semipinnata |
PubChem | 14610560 |
LOTUS | LTS0101392 |
wikiData | Q105134427 |