[(2S,3R,4S,5R)-3-acetyloxy-2-[[(1S,3R,6S,8S,9S,11S,12S,14R,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxyoxan-4-yl] acetate
| Internal ID | d1646ead-b956-4010-9bd1-9f8e88fedc60 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [(2S,3R,4S,5R)-3-acetyloxy-2-[[(1S,3R,6S,8S,9S,11S,12S,14R,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxyoxan-4-yl] acetate |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)OC(=O)C)OC(=O)C)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
| SMILES (Isomeric) | C[C@H](CC[C@@H](C(C)(C)O)O)[C@H]1[C@@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2C[C@@H]([C@H]5[C@]3(C4)CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)OC(=O)C)OC(=O)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)O |
| InChI | InChI=1S/C45H74O16/c1-21(10-11-29(51)41(6,7)55)31-24(49)17-43(9)28-16-26(59-38-34(54)33(53)32(52)27(18-46)60-38)37-40(4,5)30(12-13-45(37)20-44(28,45)15-14-42(31,43)8)61-39-36(58-23(3)48)35(57-22(2)47)25(50)19-56-39/h21,24-39,46,49-55H,10-20H2,1-9H3/t21-,24-,25-,26+,27-,28+,29+,30+,31+,32-,33+,34-,35+,36-,37-,38-,39+,42-,43+,44+,45-/m1/s1 |
| InChI Key | ZQWCDHXEDOSWFH-XKYNYHLDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H74O16 |
| Molecular Weight | 871.10 g/mol |
| Exact Mass | 870.49768627 g/mol |
| Topological Polar Surface Area (TPSA) | 251.00 Ų |
| XlogP | 2.60 |
| Atomic LogP (AlogP) | 1.71 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 12 |
| There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R)-3-acetyloxy-2-[[(1S,3R,6S,8S,9S,11S,12S,14R,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxyoxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/5431bed0-8634-11ee-9050-0f4f2ef51356.jpg "2D Structure of [(2S,3R,4S,5R)-3-acetyloxy-2-[[(1S,3R,6S,8S,9S,11S,12S,14R,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxyoxan-4-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5583 | 55.83% |
| Caco-2 | - | 0.8822 | 88.22% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.7272 | 72.72% |
| OATP2B1 inhibitior | - | 0.8749 | 87.49% |
| OATP1B1 inhibitior | + | 0.8054 | 80.54% |
| OATP1B3 inhibitior | + | 0.9129 | 91.29% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6250 | 62.50% |
| BSEP inhibitior | + | 0.6933 | 69.33% |
| P-glycoprotein inhibitior | + | 0.7749 | 77.49% |
| P-glycoprotein substrate | + | 0.5891 | 58.91% |
| CYP3A4 substrate | + | 0.7390 | 73.90% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8804 | 88.04% |
| CYP3A4 inhibition | - | 0.8492 | 84.92% |
| CYP2C9 inhibition | - | 0.7876 | 78.76% |
| CYP2C19 inhibition | - | 0.8640 | 86.40% |
| CYP2D6 inhibition | - | 0.9553 | 95.53% |
| CYP1A2 inhibition | - | 0.9034 | 90.34% |
| CYP2C8 inhibition | + | 0.6686 | 66.86% |
| CYP inhibitory promiscuity | - | 0.9765 | 97.65% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.6966 | 69.66% |
| Eye corrosion | - | 0.9897 | 98.97% |
| Eye irritation | - | 0.9069 | 90.69% |
| Skin irritation | - | 0.6943 | 69.43% |
| Skin corrosion | - | 0.9413 | 94.13% |
| Ames mutagenesis | - | 0.6048 | 60.48% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6548 | 65.48% |
| Micronuclear | - | 0.7700 | 77.00% |
| Hepatotoxicity | - | 0.6940 | 69.40% |
| skin sensitisation | - | 0.9222 | 92.22% |
| Respiratory toxicity | - | 0.5000 | 50.00% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | + | 0.5250 | 52.50% |
| Nephrotoxicity | - | 0.7958 | 79.58% |
| Acute Oral Toxicity (c) | I | 0.5104 | 51.04% |
| Estrogen receptor binding | + | 0.7573 | 75.73% |
| Androgen receptor binding | + | 0.7404 | 74.04% |
| Thyroid receptor binding | - | 0.5659 | 56.59% |
| Glucocorticoid receptor binding | + | 0.6996 | 69.96% |
| Aromatase binding | + | 0.6753 | 67.53% |
| PPAR gamma | + | 0.7739 | 77.39% |
| Honey bee toxicity | - | 0.5931 | 59.31% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
| Fish aquatic toxicity | + | 0.8965 | 89.65% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.50% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.89% | 91.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.83% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.65% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.08% | 97.09% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 92.15% | 82.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.74% | 96.47% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.49% | 92.88% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.00% | 95.58% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.64% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.36% | 85.14% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.41% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.31% | 97.14% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.13% | 94.62% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 88.06% | 99.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.89% | 96.77% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.66% | 98.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.45% | 89.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.39% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.35% | 89.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.54% | 95.93% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.52% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.46% | 91.19% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.15% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.87% | 96.95% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 85.50% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.49% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.40% | 92.86% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.27% | 97.21% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.09% | 97.79% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.98% | 95.71% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.94% | 97.29% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.65% | 94.08% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.74% | 95.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.72% | 94.33% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 82.66% | 95.69% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.58% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.42% | 86.33% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.11% | 93.18% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 82.07% | 92.86% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.95% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.71% | 92.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.51% | 95.38% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.39% | 94.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.30% | 100.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.23% | 90.24% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.94% | 96.21% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.93% | 91.03% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.74% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.66% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.04% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus trimestris |
| PubChem | 162997761 |
| LOTUS | LTS0239024 |
| wikiData | Q105381795 |