5,4'-Dihidroxy-7,8,2',3'-tetramethoxy flavone 5-glucoside
Internal ID | 853c1405-400e-4452-bb85-4b824c665323 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-(4-hydroxy-2,3-dimethoxyphenyl)-7,8-dimethoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C=C(O2)C4=C(C(=C(C=C4)O)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C=C(O2)C4=C(C(=C(C=C4)O)OC)OC)OC |
InChI | InChI=1S/C25H28O13/c1-32-15-8-14(37-25-20(31)19(30)18(29)16(9-26)38-25)17-12(28)7-13(36-24(17)23(15)35-4)10-5-6-11(27)22(34-3)21(10)33-2/h5-8,16,18-20,25-27,29-31H,9H2,1-4H3 |
InChI Key | DOOHDGFTLGCFTC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O13 |
Molecular Weight | 536.50 g/mol |
Exact Mass | 536.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 0.60 |
CHEBI:168551 |
LMPK12111417 |
2-(4-hydroxy-2,3-dimethoxyphenyl)-7,8-dimethoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.22% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.69% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.65% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.63% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.92% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.56% | 96.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.80% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 86.60% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.53% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.58% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.38% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis paniculata |
PubChem | 13963764 |
LOTUS | LTS0039075 |
wikiData | Q104986111 |