3-[[(2R,3S,4R,5S,6S)-6-[3-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-3-[(2S,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid
Internal ID | 14d5925d-f824-4bcb-8e7c-3964c13f62ff |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | 3-[[(2R,3S,4R,5S,6S)-6-[3-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-3-[(2S,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
SMILES (Canonical) | C1C(C(C(C(O1)OC2C(C(C(OC2OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)COC(=O)CC(=O)O)O)O)O)O)C6=CC(=C(C=C6)O)O)COC(=O)C=CC7=CC=C(C=C7)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]([C@@H]([C@H](O[C@H]2OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@H]([C@@H]([C@@H]([C@H](O5)COC(=O)CC(=O)O)O)O)O)O)C6=CC(=C(C=C6)O)O)COC(=O)C=CC7=CC=C(C=C7)O)O)O)O)O)O |
InChI | InChI=1S/C44H46O25/c45-19-5-1-17(2-6-19)3-8-31(52)61-15-29-35(56)37(58)41(69-42-38(59)33(54)24(49)14-63-42)44(68-29)66-27-12-21-25(64-40(27)18-4-7-22(47)23(48)9-18)10-20(46)11-26(21)65-43-39(60)36(57)34(55)28(67-43)16-62-32(53)13-30(50)51/h1-12,24,28-29,33-39,41-44,49,54-60H,13-16H2,(H4-,45,46,47,48,50,51,52)/p+1/t24-,28-,29-,33-,34-,35-,36-,37-,38-,39+,41+,42+,43-,44-/m1/s1 |
InChI Key | JKGXHHXZZLNEGD-XUYFGVRGSA-O |
Popularity | 0 references in papers |
Molecular Formula | C44H47O25+ |
Molecular Weight | 975.80 g/mol |
Exact Mass | 975.24064198 g/mol |
Topological Polar Surface Area (TPSA) | 389.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.98% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.10% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.06% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.38% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.74% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.39% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.25% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.81% | 95.93% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.77% | 95.83% |
CHEMBL3194 | P02766 | Transthyretin | 89.77% | 90.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.37% | 83.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.22% | 98.95% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 88.90% | 97.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.03% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.95% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.07% | 89.62% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.20% | 85.31% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.18% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.13% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.99% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.15% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.43% | 94.75% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.16% | 91.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.31% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 163190798 |
LOTUS | LTS0057173 |
wikiData | Q23464928 |