5-Acetamido-2-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(2-acetamido-1,4,5,6-tetrahydroxyhexan-3-yl)oxy-3-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid
| Internal ID | 448b22b8-dcf8-49c4-b9cf-d1605b783c08 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Neuraminic acids and derivatives > Neuraminic acids |
| IUPAC Name | 5-acetamido-2-[5-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(2-acetamido-1,4,5,6-tetrahydroxyhexan-3-yl)oxy-3-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES (Canonical) | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)NC(=O)C)CO)OC(C(CO)NC(=O)C)C(C(CO)O)O)O)O |
| SMILES (Isomeric) | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)NC(=O)C)CO)OC(C(CO)NC(=O)C)C(C(CO)O)O)O)O |
| InChI | InChI=1S/C33H57N3O24/c1-10(42)34-13(5-37)26(21(48)15(46)6-38)57-31-25(52)29(27(18(9-41)56-31)58-30-20(36-12(3)44)24(51)23(50)17(8-40)55-30)60-33(32(53)54)4-14(45)19(35-11(2)43)28(59-33)22(49)16(47)7-39/h13-31,37-41,45-52H,4-9H2,1-3H3,(H,34,42)(H,35,43)(H,36,44)(H,53,54) |
| InChI Key | YYMONVVGQUJSIH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H57N3O24 |
| Molecular Weight | 879.80 g/mol |
| Exact Mass | 879.33319969 g/mol |
| Topological Polar Surface Area (TPSA) | 443.00 Ų |
| XlogP | -9.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.87% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.87% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.59% | 98.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.45% | 91.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.21% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.39% | 89.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.99% | 96.61% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.90% | 92.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.87% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.31% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.96% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.70% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.51% | 95.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.08% | 98.05% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.70% | 97.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.27% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.70% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.40% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162931104 |
| LOTUS | LTS0083671 |
| wikiData | Q105176222 |